About 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid
3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid (PubChem CID 83028277) has the molecular formula C14H26N2O4
and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid |
| PubChem CID | 83028277 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid |
| SMILES | CC(C)N(CCC(=O)O)C(=O)NC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H26N2O4/c1-10(2)16(7-5-12(17)18)13(19)15-11-6-8-20-14(3,4)9-11/h10-11H,5-9H2,1-4H3,(H,15,19)(H,17,18) |
| InChIKey | JAJQYRARTROVJL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid?
The IUPAC name of 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid (CID 83028277) is 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid.
What is the SMILES notation for 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid?
The canonical SMILES for 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid is CC(C)N(CCC(=O)O)C(=O)NC1CCOC(C)(C)C1.
What is the InChIKey of 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid?
The InChIKey is JAJQYRARTROVJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O4/c1-10(2)16(7-5-12(17)18)13(19)15-11-6-8-20-14(3,4)9-11/h10-11H,5-9H2,1-4H3,(H,15,19)(H,17,18).
What are the key properties of 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid?
3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid has a molecular weight of 286.37 g/mol, XLogP of 1.84, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-dimethyloxan-4-yl)carbamoyl-propan-2-ylamino]propanoic acid is sourced from PubChem (CID 83028277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).