1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid

C14H17N3O3 — CID 83028566

IUPAC1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid
SMILESCC1(C)CC(n2nnc3c(C(=O)O)cccc32)CCO1
InChIInChI=1S/C14H17N3O3/c1-14(2)8-9(6-7-20-14)17-11-5-3-4-10(13(18)19)12(11)15-16-17/h3-5,9H,6-8H2,1-2H3,(H,18,19)
InChIKeyFXKIKFWRHBVIQQ-UHFFFAOYSA-N
MW275.31 g/mol
LogP2.26
Rot. Bonds2

About 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid

1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid (PubChem CID 83028566) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid.

Molecular Properties

Compound Name1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid
PubChem CID83028566
Molecular FormulaC14H17N3O3
Molecular Weight275.31 g/mol
Exact Mass275.13
IUPAC Name1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid
SMILESCC1(C)CC(n2nnc3c(C(=O)O)cccc32)CCO1
InChIInChI=1S/C14H17N3O3/c1-14(2)8-9(6-7-20-14)17-11-5-3-4-10(13(18)19)12(11)15-16-17/h3-5,9H,6-8H2,1-2H3,(H,18,19)
InChIKeyFXKIKFWRHBVIQQ-UHFFFAOYSA-N
XLogP2.26
TPSA77.24 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.31
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid?
The IUPAC name of 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid (CID 83028566) is 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid.
What is the SMILES notation for 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid?
The canonical SMILES for 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid is CC1(C)CC(n2nnc3c(C(=O)O)cccc32)CCO1.
What is the InChIKey of 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid?
The InChIKey is FXKIKFWRHBVIQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-14(2)8-9(6-7-20-14)17-11-5-3-4-10(13(18)19)12(11)15-16-17/h3-5,9H,6-8H2,1-2H3,(H,18,19).
What are the key properties of 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid?
1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid has a molecular weight of 275.31 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethyloxan-4-yl)benzotriazole-4-carboxylic acid is sourced from PubChem (CID 83028566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).