C14H23NO3 — CID 83028865
1-(2,2-diethyloxan-4-yl)piperidine-2,4-dione (PubChem CID 83028865) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-(2,2-diethyloxan-4-yl)piperidine-2,4-dione.
| Compound Name | 1-(2,2-diethyloxan-4-yl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 83028865 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-(2,2-diethyloxan-4-yl)piperidine-2,4-dione |
| SMILES | CCC1(CC)CC(N2CCC(=O)CC2=O)CCO1 |
| InChI | InChI=1S/C14H23NO3/c1-3-14(4-2)10-11(6-8-18-14)15-7-5-12(16)9-13(15)17/h11H,3-10H2,1-2H3 |
| InChIKey | DTXCYGCCWNYODL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|