About 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine
1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine (PubChem CID 83028894) has the molecular formula C14H17F2N3O
and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine.
Molecular Properties
| Compound Name | 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine |
| PubChem CID | 83028894 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine |
| SMILES | CC1(C)CC(n2c(N)nc3c(F)cc(F)cc32)CCO1 |
| InChI | InChI=1S/C14H17F2N3O/c1-14(2)7-9(3-4-20-14)19-11-6-8(15)5-10(16)12(11)18-13(19)17/h5-6,9H,3-4,7H2,1-2H3,(H2,17,18) |
| InChIKey | YBXAJZRHGZCHLE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine?
The IUPAC name of 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine (CID 83028894) is 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine.
What is the SMILES notation for 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine?
The canonical SMILES for 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine is CC1(C)CC(n2c(N)nc3c(F)cc(F)cc32)CCO1.
What is the InChIKey of 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine?
The InChIKey is YBXAJZRHGZCHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2N3O/c1-14(2)7-9(3-4-20-14)19-11-6-8(15)5-10(16)12(11)18-13(19)17/h5-6,9H,3-4,7H2,1-2H3,(H2,17,18).
What are the key properties of 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine?
1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine has a molecular weight of 281.31 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethyloxan-4-yl)-4,6-difluorobenzimidazol-2-amine is sourced from PubChem (CID 83028894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).