About methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate
methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate (PubChem CID 83028949) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate |
| PubChem CID | 83028949 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NC2CCOC(C)(C)C2)n1 |
| InChI | InChI=1S/C13H19N3O3/c1-13(2)6-9(4-5-19-13)15-11-8-14-7-10(16-11)12(17)18-3/h7-9H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | JWBXWVZEVZZZSW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate?
The IUPAC name of methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate (CID 83028949) is methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate?
The canonical SMILES for methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate is COC(=O)c1cncc(NC2CCOC(C)(C)C2)n1.
What is the InChIKey of methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate?
The InChIKey is JWBXWVZEVZZZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3/c1-13(2)6-9(4-5-19-13)15-11-8-14-7-10(16-11)12(17)18-3/h7-9H,4-6H2,1-3H3,(H,15,16).
What are the key properties of methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate?
methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate has a molecular weight of 265.31 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(2,2-dimethyloxan-4-yl)amino]pyrazine-2-carboxylate is sourced from PubChem (CID 83028949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).