About 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine
3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine (PubChem CID 83029129) has the molecular formula C13H20ClN3O
and a molecular weight of 269.78 g/mol. Its IUPAC name is 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine |
| PubChem CID | 83029129 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine |
| SMILES | Cc1nc(Cl)c(NC2CCOC(C)(C)C2)nc1C |
| InChI | InChI=1S/C13H20ClN3O/c1-8-9(2)16-12(11(14)15-8)17-10-5-6-18-13(3,4)7-10/h10H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | LMOOPQPZBSUCIH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine?
The IUPAC name of 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine (CID 83029129) is 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine.
What is the SMILES notation for 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine?
The canonical SMILES for 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine is Cc1nc(Cl)c(NC2CCOC(C)(C)C2)nc1C.
What is the InChIKey of 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine?
The InChIKey is LMOOPQPZBSUCIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClN3O/c1-8-9(2)16-12(11(14)15-8)17-10-5-6-18-13(3,4)7-10/h10H,5-7H2,1-4H3,(H,16,17).
What are the key properties of 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine?
3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine has a molecular weight of 269.78 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,2-dimethyloxan-4-yl)-5,6-dimethylpyrazin-2-amine is sourced from PubChem (CID 83029129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).