About 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid
2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid (PubChem CID 83029239) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid |
| PubChem CID | 83029239 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid |
| SMILES | CCC1(CC)CC(Nc2ncccc2C(=O)O)CCO1 |
| InChI | InChI=1S/C15H22N2O3/c1-3-15(4-2)10-11(7-9-20-15)17-13-12(14(18)19)6-5-8-16-13/h5-6,8,11H,3-4,7,9-10H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | CTGRWWUEVQXOGQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid?
The IUPAC name of 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid (CID 83029239) is 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid?
The canonical SMILES for 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid is CCC1(CC)CC(Nc2ncccc2C(=O)O)CCO1.
What is the InChIKey of 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid?
The InChIKey is CTGRWWUEVQXOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-3-15(4-2)10-11(7-9-20-15)17-13-12(14(18)19)6-5-8-16-13/h5-6,8,11H,3-4,7,9-10H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid?
2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid has a molecular weight of 278.35 g/mol, XLogP of 2.93, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-diethyloxan-4-yl)amino]pyridine-3-carboxylic acid is sourced from PubChem (CID 83029239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).