C15H26N2O2 — CID 83029363
4-amino-N-(2,2-diethyloxan-4-yl)cyclopent-2-ene-1-carboxamide (PubChem CID 83029363) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-amino-N-(2,2-diethyloxan-4-yl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(2,2-diethyloxan-4-yl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 83029363 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4-amino-N-(2,2-diethyloxan-4-yl)cyclopent-2-ene-1-carboxamide |
| SMILES | CCC1(CC)CC(NC(=O)C2C=CC(N)C2)CCO1 |
| InChI | InChI=1S/C15H26N2O2/c1-3-15(4-2)10-13(7-8-19-15)17-14(18)11-5-6-12(16)9-11/h5-6,11-13H,3-4,7-10,16H2,1-2H3,(H,17,18) |
| InChIKey | YKKDPFIZFGNBAO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|