C13H19NO4 — CID 83031383
2-(2,4-dimethoxyphenyl)-N-[(2R)-2-hydroxypropyl]acetamide (PubChem CID 83031383) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-N-[(2R)-2-hydroxypropyl]acetamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-N-[(2R)-2-hydroxypropyl]acetamide |
|---|---|
| PubChem CID | 83031383 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-N-[(2R)-2-hydroxypropyl]acetamide |
| SMILES | COc1ccc(CC(=O)NC[C@@H](C)O)c(OC)c1 |
| InChI | InChI=1S/C13H19NO4/c1-9(15)8-14-13(16)6-10-4-5-11(17-2)7-12(10)18-3/h4-5,7,9,15H,6,8H2,1-3H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | DAVMQDALEXSJKK-SECBINFHSA-N |
| XLogP | 0.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |