C11H21N5 — CID 83031460
N-(diaminomethylidene)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide (PubChem CID 83031460) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(diaminomethylidene)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-(diaminomethylidene)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 83031460 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N-(diaminomethylidene)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C11H21N5/c12-10(13)15-11(14)16-6-5-8-3-1-2-4-9(8)7-16/h8-9H,1-7H2,(H5,12,13,14,15) |
| InChIKey | GYGPSTMSEIUZRJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|