C15H30N2O3 — CID 83032600
tert-butyl N-[3-[(2,2-dimethyloxan-4-yl)amino]propyl]carbamate (PubChem CID 83032600) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is tert-butyl N-[3-[(2,2-dimethyloxan-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2,2-dimethyloxan-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 83032600 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | tert-butyl N-[3-[(2,2-dimethyloxan-4-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C15H30N2O3/c1-14(2,3)20-13(18)17-9-6-8-16-12-7-10-19-15(4,5)11-12/h12,16H,6-11H2,1-5H3,(H,17,18) |
| InChIKey | PWIOWAPFGSDBHZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|