C15H30N2O2 — CID 83032657
2-[(2,2-diethyloxan-4-yl)amino]-N-propylpropanamide (PubChem CID 83032657) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-[(2,2-diethyloxan-4-yl)amino]-N-propylpropanamide.
| Compound Name | 2-[(2,2-diethyloxan-4-yl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 83032657 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 2-[(2,2-diethyloxan-4-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NC1CCOC(CC)(CC)C1 |
| InChI | InChI=1S/C15H30N2O2/c1-5-9-16-14(18)12(4)17-13-8-10-19-15(6-2,7-3)11-13/h12-13,17H,5-11H2,1-4H3,(H,16,18) |
| InChIKey | ZTYPULSLNPPLFI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |