About N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine
N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine (PubChem CID 83033214) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine.
Molecular Properties
| Compound Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine |
| PubChem CID | 83033214 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine |
| SMILES | CCC1(CC)CC(NCC2CCC=CO2)CCO1 |
| InChI | InChI=1S/C15H27NO2/c1-3-15(4-2)11-13(8-10-18-15)16-12-14-7-5-6-9-17-14/h6,9,13-14,16H,3-5,7-8,10-12H2,1-2H3 |
| InChIKey | FIWYWCXCCPQJTG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine?
The IUPAC name of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine (CID 83033214) is N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine.
What is the SMILES notation for N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine?
The canonical SMILES for N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine is CCC1(CC)CC(NCC2CCC=CO2)CCO1.
What is the InChIKey of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine?
The InChIKey is FIWYWCXCCPQJTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-3-15(4-2)11-13(8-10-18-15)16-12-14-7-5-6-9-17-14/h6,9,13-14,16H,3-5,7-8,10-12H2,1-2H3.
What are the key properties of N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine?
N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine has a molecular weight of 253.39 g/mol, XLogP of 3.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydro-2H-pyran-2-ylmethyl)-2,2-diethyloxan-4-amine is sourced from PubChem (CID 83033214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).