About 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol
1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol (PubChem CID 83033246) has the molecular formula C15H21Cl2NO2
and a molecular weight of 318.24 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol.
Molecular Properties
| Compound Name | 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol |
| PubChem CID | 83033246 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol |
| SMILES | CC1(C)CC(NCC(O)c2cc(Cl)ccc2Cl)CCO1 |
| InChI | InChI=1S/C15H21Cl2NO2/c1-15(2)8-11(5-6-20-15)18-9-14(19)12-7-10(16)3-4-13(12)17/h3-4,7,11,14,18-19H,5-6,8-9H2,1-2H3 |
| InChIKey | ADCGFFIAHZYJNM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol?
The IUPAC name of 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol (CID 83033246) is 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol.
What is the SMILES notation for 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol?
The canonical SMILES for 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol is CC1(C)CC(NCC(O)c2cc(Cl)ccc2Cl)CCO1.
What is the InChIKey of 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol?
The InChIKey is ADCGFFIAHZYJNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2NO2/c1-15(2)8-11(5-6-20-15)18-9-14(19)12-7-10(16)3-4-13(12)17/h3-4,7,11,14,18-19H,5-6,8-9H2,1-2H3.
What are the key properties of 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol?
1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol has a molecular weight of 318.24 g/mol, XLogP of 3.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dichlorophenyl)-2-[(2,2-dimethyloxan-4-yl)amino]ethanol is sourced from PubChem (CID 83033246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).