About N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine
N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 83033424) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 83033424 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CC1(C)CC(NC2=NCCC2)CCO1 |
| InChI | InChI=1S/C11H20N2O/c1-11(2)8-9(5-7-14-11)13-10-4-3-6-12-10/h9H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | PWSRQHKMMUGCMF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine (CID 83033424) is N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine is CC1(C)CC(NC2=NCCC2)CCO1.
What is the InChIKey of N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is PWSRQHKMMUGCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-11(2)8-9(5-7-14-11)13-10-4-3-6-12-10/h9H,3-8H2,1-2H3,(H,12,13).
What are the key properties of N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine?
N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 196.29 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 83033424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).