C12H22F3NO2 — CID 83033680
3-[(2,2-diethyloxan-4-yl)amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 83033680) has the molecular formula C12H22F3NO2 and a molecular weight of 269.31 g/mol. Its IUPAC name is 3-[(2,2-diethyloxan-4-yl)amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[(2,2-diethyloxan-4-yl)amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 83033680 |
| Molecular Formula | C12H22F3NO2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 3-[(2,2-diethyloxan-4-yl)amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCC1(CC)CC(NCC(O)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C12H22F3NO2/c1-3-11(4-2)7-9(5-6-18-11)16-8-10(17)12(13,14)15/h9-10,16-17H,3-8H2,1-2H3 |
| InChIKey | NHNQVRQRGZSDQT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |