C9H17N5 — CID 83034391
N-(diaminomethylidene)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidamide (PubChem CID 83034391) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is N-(diaminomethylidene)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidamide.
| Compound Name | N-(diaminomethylidene)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidamide |
|---|---|
| PubChem CID | 83034391 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | N-(diaminomethylidene)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CC2CCCC2C1 |
| InChI | InChI=1S/C9H17N5/c10-8(11)13-9(12)14-4-6-2-1-3-7(6)5-14/h6-7H,1-5H2,(H5,10,11,12,13) |
| InChIKey | VZNKCIWQFUZIAE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|