C12H6F5NO2S — CID 83034587
3-amino-4-methyl-5-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carboxylic acid (PubChem CID 83034587) has the molecular formula C12H6F5NO2S and a molecular weight of 323.24 g/mol. Its IUPAC name is 3-amino-4-methyl-5-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carboxylic acid.
| Compound Name | 3-amino-4-methyl-5-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 83034587 |
| Molecular Formula | C12H6F5NO2S |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 3-amino-4-methyl-5-(2,3,4,5,6-pentafluorophenyl)thiophene-2-carboxylic acid |
| SMILES | Cc1c(-c2c(F)c(F)c(F)c(F)c2F)sc(C(=O)O)c1N |
| InChI | InChI=1S/C12H6F5NO2S/c1-2-9(18)11(12(19)20)21-10(2)3-4(13)6(15)8(17)7(16)5(3)14/h18H2,1H3,(H,19,20) |
| InChIKey | YOWAORJOFKLABN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|