C10H9NO3S2 — CID 83034669
3-amino-5-(3-methoxythiophen-2-yl)thiophene-2-carboxylic acid (PubChem CID 83034669) has the molecular formula C10H9NO3S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-amino-5-(3-methoxythiophen-2-yl)thiophene-2-carboxylic acid.
| Compound Name | 3-amino-5-(3-methoxythiophen-2-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 83034669 |
| Molecular Formula | C10H9NO3S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 3-amino-5-(3-methoxythiophen-2-yl)thiophene-2-carboxylic acid |
| SMILES | COc1ccsc1-c1cc(N)c(C(=O)O)s1 |
| InChI | InChI=1S/C10H9NO3S2/c1-14-6-2-3-15-9(6)7-4-5(11)8(16-7)10(12)13/h2-4H,11H2,1H3,(H,12,13) |
| InChIKey | XVJKUUVTSARCAW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |