C14H14BrNO3S — CID 83035166
3-amino-5-(3-bromo-4-methoxyphenyl)-4-ethylthiophene-2-carboxylic acid (PubChem CID 83035166) has the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. Its IUPAC name is 3-amino-5-(3-bromo-4-methoxyphenyl)-4-ethylthiophene-2-carboxylic acid.
| Compound Name | 3-amino-5-(3-bromo-4-methoxyphenyl)-4-ethylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 83035166 |
| Molecular Formula | C14H14BrNO3S |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 3-amino-5-(3-bromo-4-methoxyphenyl)-4-ethylthiophene-2-carboxylic acid |
| SMILES | CCc1c(-c2ccc(OC)c(Br)c2)sc(C(=O)O)c1N |
| InChI | InChI=1S/C14H14BrNO3S/c1-3-8-11(16)13(14(17)18)20-12(8)7-4-5-10(19-2)9(15)6-7/h4-6H,3,16H2,1-2H3,(H,17,18) |
| InChIKey | MIZMBPQZZWEBLV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |