C16H24N2O3 — CID 83035256
ethyl 2-amino-3-[(2,2-dimethyloxan-4-yl)amino]benzoate (PubChem CID 83035256) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl 2-amino-3-[(2,2-dimethyloxan-4-yl)amino]benzoate.
| Compound Name | ethyl 2-amino-3-[(2,2-dimethyloxan-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 83035256 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | ethyl 2-amino-3-[(2,2-dimethyloxan-4-yl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC2CCOC(C)(C)C2)c1N |
| InChI | InChI=1S/C16H24N2O3/c1-4-20-15(19)12-6-5-7-13(14(12)17)18-11-8-9-21-16(2,3)10-11/h5-7,11,18H,4,8-10,17H2,1-3H3 |
| InChIKey | YMBWKJDMDQWIMM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|