C9H16N6O — CID 83035538
N-(diaminomethylidene)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboximidamide (PubChem CID 83035538) has the molecular formula C9H16N6O and a molecular weight of 224.27 g/mol. Its IUPAC name is N-(diaminomethylidene)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboximidamide.
| Compound Name | N-(diaminomethylidene)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 83035538 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | N-(diaminomethylidene)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCN2C(=O)CCC2C1 |
| InChI | InChI=1S/C9H16N6O/c10-8(11)13-9(12)14-3-4-15-6(5-14)1-2-7(15)16/h6H,1-5H2,(H5,10,11,12,13) |
| InChIKey | ZYUAAVYQGCDWHN-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|