C18H34N2O — CID 83036072
5-cyclopropyl-1-(2,2-diethyloxan-4-yl)-2-ethylpiperazine (PubChem CID 83036072) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is 5-cyclopropyl-1-(2,2-diethyloxan-4-yl)-2-ethylpiperazine.
| Compound Name | 5-cyclopropyl-1-(2,2-diethyloxan-4-yl)-2-ethylpiperazine |
|---|---|
| PubChem CID | 83036072 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 5-cyclopropyl-1-(2,2-diethyloxan-4-yl)-2-ethylpiperazine |
| SMILES | CCC1CNC(C2CC2)CN1C1CCOC(CC)(CC)C1 |
| InChI | InChI=1S/C18H34N2O/c1-4-15-12-19-17(14-7-8-14)13-20(15)16-9-10-21-18(5-2,6-3)11-16/h14-17,19H,4-13H2,1-3H3 |
| InChIKey | XRZUILKJNNBERI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |