C16H28N2O3 — CID 83036095
3-butan-2-yl-1-(2,2-dimethyloxan-4-yl)-1,4-diazepane-2,5-dione (PubChem CID 83036095) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-butan-2-yl-1-(2,2-dimethyloxan-4-yl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-butan-2-yl-1-(2,2-dimethyloxan-4-yl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 83036095 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 3-butan-2-yl-1-(2,2-dimethyloxan-4-yl)-1,4-diazepane-2,5-dione |
| SMILES | CCC(C)C1NC(=O)CCN(C2CCOC(C)(C)C2)C1=O |
| InChI | InChI=1S/C16H28N2O3/c1-5-11(2)14-15(20)18(8-6-13(19)17-14)12-7-9-21-16(3,4)10-12/h11-12,14H,5-10H2,1-4H3,(H,17,19) |
| InChIKey | DNHGOKFXXKOAKX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |