About ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate
ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate (PubChem CID 83036421) has the molecular formula C16H31NO3
and a molecular weight of 285.43 g/mol. Its IUPAC name is ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate.
Analyze ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate?
The IUPAC name of ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate (CID 83036421) is ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate.
What is the SMILES notation for ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate?
The canonical SMILES for ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate is CCCC(OC1(CN)CCC(C)(C)CC1)C(=O)OCC.
What is the InChIKey of ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate?
The InChIKey is PKGLDECIENVDIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO3/c1-5-7-13(14(18)19-6-2)20-16(12-17)10-8-15(3,4)9-11-16/h13H,5-12,17H2,1-4H3.
What are the key properties of ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate?
ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate has a molecular weight of 285.43 g/mol, XLogP of 3.03, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxypentanoate is sourced from PubChem (CID 83036421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).