C7H14N6O — CID 83036780
N-(diaminomethylidene)-2-methyl-3-oxopiperazine-1-carboximidamide (PubChem CID 83036780) has the molecular formula C7H14N6O and a molecular weight of 198.23 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-methyl-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-(diaminomethylidene)-2-methyl-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 83036780 |
| Molecular Formula | C7H14N6O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-(diaminomethylidene)-2-methyl-3-oxopiperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCNC(=O)C1C |
| InChI | InChI=1S/C7H14N6O/c1-4-5(14)11-2-3-13(4)7(10)12-6(8)9/h4H,2-3H2,1H3,(H,11,14)(H5,8,9,10,12) |
| InChIKey | QSLLBEBJDQYRTH-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|