C12H16O5S — CID 83037663
2-(2-methoxyphenyl)sulfonylpentanoic acid (PubChem CID 83037663) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)sulfonylpentanoic acid.
| Compound Name | 2-(2-methoxyphenyl)sulfonylpentanoic acid |
|---|---|
| PubChem CID | 83037663 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-(2-methoxyphenyl)sulfonylpentanoic acid |
| SMILES | CCCC(C(=O)O)S(=O)(=O)c1ccccc1OC |
| InChI | InChI=1S/C12H16O5S/c1-3-6-11(12(13)14)18(15,16)10-8-5-4-7-9(10)17-2/h4-5,7-8,11H,3,6H2,1-2H3,(H,13,14) |
| InChIKey | WMCGRLBENRIHAU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |