C14H21NO4 — CID 83037676
2-[4-[(1S)-1-aminoethyl]-2-methoxyphenoxy]pentanoic acid (PubChem CID 83037676) has the molecular formula C14H21NO4 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[4-[(1S)-1-aminoethyl]-2-methoxyphenoxy]pentanoic acid.
| Compound Name | 2-[4-[(1S)-1-aminoethyl]-2-methoxyphenoxy]pentanoic acid |
|---|---|
| PubChem CID | 83037676 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-[4-[(1S)-1-aminoethyl]-2-methoxyphenoxy]pentanoic acid |
| SMILES | CCCC(Oc1ccc([C@H](C)N)cc1OC)C(=O)O |
| InChI | InChI=1S/C14H21NO4/c1-4-5-12(14(16)17)19-11-7-6-10(9(2)15)8-13(11)18-3/h6-9,12H,4-5,15H2,1-3H3,(H,16,17)/t9-,12?/m0/s1 |
| InChIKey | RTDZBBDDOGJUKB-QHGLUPRGSA-N |
| XLogP | 2.35 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |