C9H18N4OS — CID 83039936
N'-(3-ethyl-1,2,4-thiadiazol-5-yl)-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 83039936) has the molecular formula C9H18N4OS and a molecular weight of 230.34 g/mol. Its IUPAC name is N'-(3-ethyl-1,2,4-thiadiazol-5-yl)-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | N'-(3-ethyl-1,2,4-thiadiazol-5-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 83039936 |
| Molecular Formula | C9H18N4OS |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N'-(3-ethyl-1,2,4-thiadiazol-5-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | CCc1nsc(NCCNCCOC)n1 |
| InChI | InChI=1S/C9H18N4OS/c1-3-8-12-9(15-13-8)11-5-4-10-6-7-14-2/h10H,3-7H2,1-2H3,(H,11,12,13) |
| InChIKey | ITHKEZPXPGISES-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|