C18H22BrNO — CID 83039979
9-bromo-N,2-dipropyl-2,3-dihydrobenzo[f][1]benzofuran-3-amine (PubChem CID 83039979) has the molecular formula C18H22BrNO and a molecular weight of 348.28 g/mol. Its IUPAC name is 9-bromo-N,2-dipropyl-2,3-dihydrobenzo[f][1]benzofuran-3-amine.
| Compound Name | 9-bromo-N,2-dipropyl-2,3-dihydrobenzo[f][1]benzofuran-3-amine |
|---|---|
| PubChem CID | 83039979 |
| Molecular Formula | C18H22BrNO |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 9-bromo-N,2-dipropyl-2,3-dihydrobenzo[f][1]benzofuran-3-amine |
| SMILES | CCCNC1c2cc3ccccc3c(Br)c2OC1CCC |
| InChI | InChI=1S/C18H22BrNO/c1-3-7-15-17(20-10-4-2)14-11-12-8-5-6-9-13(12)16(19)18(14)21-15/h5-6,8-9,11,15,17,20H,3-4,7,10H2,1-2H3 |
| InChIKey | XMJXVKKPVPSAFU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |