C12H19N3O — CID 83040213
6-N-(2,2-dimethyloxan-4-yl)pyridine-2,6-diamine (PubChem CID 83040213) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 6-N-(2,2-dimethyloxan-4-yl)pyridine-2,6-diamine.
| Compound Name | 6-N-(2,2-dimethyloxan-4-yl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 83040213 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 6-N-(2,2-dimethyloxan-4-yl)pyridine-2,6-diamine |
| SMILES | CC1(C)CC(Nc2cccc(N)n2)CCO1 |
| InChI | InChI=1S/C12H19N3O/c1-12(2)8-9(6-7-16-12)14-11-5-3-4-10(13)15-11/h3-5,9H,6-8H2,1-2H3,(H3,13,14,15) |
| InChIKey | ZBFUBJRMLXVYST-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |