C13H17FO4 — CID 83041479
2-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenoxy]pentanoic acid (PubChem CID 83041479) has the molecular formula C13H17FO4 and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenoxy]pentanoic acid.
| Compound Name | 2-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 83041479 |
| Molecular Formula | C13H17FO4 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenoxy]pentanoic acid |
| SMILES | CCCC(Oc1ccc(F)cc1[C@@H](C)O)C(=O)O |
| InChI | InChI=1S/C13H17FO4/c1-3-4-12(13(16)17)18-11-6-5-9(14)7-10(11)8(2)15/h5-8,12,15H,3-4H2,1-2H3,(H,16,17)/t8-,12?/m1/s1 |
| InChIKey | QXNUIUOLQDGNFS-SZSXPDSJSA-N |
| XLogP | 2.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |