C11H18N2O4 — CID 83042036
2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)pentanoic acid (PubChem CID 83042036) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)pentanoic acid.
| Compound Name | 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 83042036 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)pentanoic acid |
| SMILES | CCCC(C(=O)O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C11H18N2O4/c1-4-5-7(9(15)16)13-6-8(14)12-10(17)11(13,2)3/h7H,4-6H2,1-3H3,(H,15,16)(H,12,14,17) |
| InChIKey | JPZWCUDAJKOYBP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|