2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid

C11H18N2O3 — CID 83042350

IUPAC2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid
SMILESCCCC(C(=O)O)C(O)c1cnn(C)c1C
InChIInChI=1S/C11H18N2O3/c1-4-5-8(11(15)16)10(14)9-6-12-13(3)7(9)2/h6,8,10,14H,4-5H2,1-3H3,(H,15,16)
InChIKeyPAJUMJXHHRFZTR-UHFFFAOYSA-N
MW226.28 g/mol
LogP1.26
Rot. Bonds5

About 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid

2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid (PubChem CID 83042350) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid.

Molecular Properties

Compound Name2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid
PubChem CID83042350
Molecular FormulaC11H18N2O3
Molecular Weight226.28 g/mol
Exact Mass226.13
IUPAC Name2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid
SMILESCCCC(C(=O)O)C(O)c1cnn(C)c1C
InChIInChI=1S/C11H18N2O3/c1-4-5-8(11(15)16)10(14)9-6-12-13(3)7(9)2/h6,8,10,14H,4-5H2,1-3H3,(H,15,16)
InChIKeyPAJUMJXHHRFZTR-UHFFFAOYSA-N
XLogP1.26
TPSA75.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.28
LogP ≤ 51.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid?
The IUPAC name of 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid (CID 83042350) is 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid.
What is the SMILES notation for 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid?
The canonical SMILES for 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid is CCCC(C(=O)O)C(O)c1cnn(C)c1C.
What is the InChIKey of 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid?
The InChIKey is PAJUMJXHHRFZTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-4-5-8(11(15)16)10(14)9-6-12-13(3)7(9)2/h6,8,10,14H,4-5H2,1-3H3,(H,15,16).
What are the key properties of 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid?
2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid has a molecular weight of 226.28 g/mol, XLogP of 1.26, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,5-dimethylpyrazol-4-yl)-hydroxymethyl]pentanoic acid is sourced from PubChem (CID 83042350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).