C13H24O4 — CID 83043572
2-(2-ethyl-4-hydroxy-2-methyloxan-4-yl)pentanoic acid (PubChem CID 83043572) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-(2-ethyl-4-hydroxy-2-methyloxan-4-yl)pentanoic acid.
| Compound Name | 2-(2-ethyl-4-hydroxy-2-methyloxan-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 83043572 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 2-(2-ethyl-4-hydroxy-2-methyloxan-4-yl)pentanoic acid |
| SMILES | CCCC(C(=O)O)C1(O)CCOC(C)(CC)C1 |
| InChI | InChI=1S/C13H24O4/c1-4-6-10(11(14)15)13(16)7-8-17-12(3,5-2)9-13/h10,16H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | KCLNZYQGOGXYHN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |