C13H24ClN3 — CID 83044250
N-tert-butyl-2-(4-chloro-3-methylpyrazol-1-yl)pentan-1-amine (PubChem CID 83044250) has the molecular formula C13H24ClN3 and a molecular weight of 257.81 g/mol. Its IUPAC name is N-tert-butyl-2-(4-chloro-3-methylpyrazol-1-yl)pentan-1-amine.
| Compound Name | N-tert-butyl-2-(4-chloro-3-methylpyrazol-1-yl)pentan-1-amine |
|---|---|
| PubChem CID | 83044250 |
| Molecular Formula | C13H24ClN3 |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N-tert-butyl-2-(4-chloro-3-methylpyrazol-1-yl)pentan-1-amine |
| SMILES | CCCC(CNC(C)(C)C)n1cc(Cl)c(C)n1 |
| InChI | InChI=1S/C13H24ClN3/c1-6-7-11(8-15-13(3,4)5)17-9-12(14)10(2)16-17/h9,11,15H,6-8H2,1-5H3 |
| InChIKey | CYMASQAFCWQERY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |