C15H20F3NO — CID 83044258
N-[2-[4-(trifluoromethyl)phenoxy]pentyl]cyclopropanamine (PubChem CID 83044258) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[2-[4-(trifluoromethyl)phenoxy]pentyl]cyclopropanamine.
| Compound Name | N-[2-[4-(trifluoromethyl)phenoxy]pentyl]cyclopropanamine |
|---|---|
| PubChem CID | 83044258 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-[2-[4-(trifluoromethyl)phenoxy]pentyl]cyclopropanamine |
| SMILES | CCCC(CNC1CC1)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3NO/c1-2-3-14(10-19-12-6-7-12)20-13-8-4-11(5-9-13)15(16,17)18/h4-5,8-9,12,14,19H,2-3,6-7,10H2,1H3 |
| InChIKey | SIGBTORMAALOLL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |