C18H24FNO — CID 83044304
3-[3-fluoro-5-[(2-propylpiperidin-1-yl)methyl]phenyl]prop-2-yn-1-ol (PubChem CID 83044304) has the molecular formula C18H24FNO and a molecular weight of 289.39 g/mol. Its IUPAC name is 3-[3-fluoro-5-[(2-propylpiperidin-1-yl)methyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-fluoro-5-[(2-propylpiperidin-1-yl)methyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 83044304 |
| Molecular Formula | C18H24FNO |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-[3-fluoro-5-[(2-propylpiperidin-1-yl)methyl]phenyl]prop-2-yn-1-ol |
| SMILES | CCCC1CCCCN1Cc1cc(F)cc(C#CCO)c1 |
| InChI | InChI=1S/C18H24FNO/c1-2-6-18-8-3-4-9-20(18)14-16-11-15(7-5-10-21)12-17(19)13-16/h11-13,18,21H,2-4,6,8-10,14H2,1H3 |
| InChIKey | HETGBSSILSYQRZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|