C18H29N3 — CID 83044523
N-[[2-methyl-6-(2-propylpiperidin-1-yl)-3-pyridinyl]methyl]cyclopropanamine (PubChem CID 83044523) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[[2-methyl-6-(2-propylpiperidin-1-yl)-3-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-methyl-6-(2-propylpiperidin-1-yl)-3-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 83044523 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | N-[[2-methyl-6-(2-propylpiperidin-1-yl)-3-pyridinyl]methyl]cyclopropanamine |
| SMILES | CCCC1CCCCN1c1ccc(CNC2CC2)c(C)n1 |
| InChI | InChI=1S/C18H29N3/c1-3-6-17-7-4-5-12-21(17)18-11-8-15(14(2)20-18)13-19-16-9-10-16/h8,11,16-17,19H,3-7,9-10,12-13H2,1-2H3 |
| InChIKey | VGTPPTGWBRCONY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |