C12H22F5NO — CID 83044775
N-tert-butyl-2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-amine (PubChem CID 83044775) has the molecular formula C12H22F5NO and a molecular weight of 291.30 g/mol. Its IUPAC name is N-tert-butyl-2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-amine.
| Compound Name | N-tert-butyl-2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-amine |
|---|---|
| PubChem CID | 83044775 |
| Molecular Formula | C12H22F5NO |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-tert-butyl-2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-amine |
| SMILES | CCCC(CNC(C)(C)C)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H22F5NO/c1-5-6-9(7-18-10(2,3)4)19-8-11(13,14)12(15,16)17/h9,18H,5-8H2,1-4H3 |
| InChIKey | CMGYEJHYTWHYIA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|