C8H14F5NO — CID 83044935
2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-amine (PubChem CID 83044935) has the molecular formula C8H14F5NO and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-amine.
| Compound Name | 2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-amine |
|---|---|
| PubChem CID | 83044935 |
| Molecular Formula | C8H14F5NO |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-(2,2,3,3,3-pentafluoropropoxy)pentan-1-amine |
| SMILES | CCCC(CN)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H14F5NO/c1-2-3-6(4-14)15-5-7(9,10)8(11,12)13/h6H,2-5,14H2,1H3 |
| InChIKey | HHWIFVRJTCHZCM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|