C16H28N4S — CID 83045067
2-methylsulfanyl-N-propyl-6-(2-propylpiperidin-1-yl)pyrimidin-4-amine (PubChem CID 83045067) has the molecular formula C16H28N4S and a molecular weight of 308.50 g/mol. Its IUPAC name is 2-methylsulfanyl-N-propyl-6-(2-propylpiperidin-1-yl)pyrimidin-4-amine.
| Compound Name | 2-methylsulfanyl-N-propyl-6-(2-propylpiperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 83045067 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-methylsulfanyl-N-propyl-6-(2-propylpiperidin-1-yl)pyrimidin-4-amine |
| SMILES | CCCNc1cc(N2CCCCC2CCC)nc(SC)n1 |
| InChI | InChI=1S/C16H28N4S/c1-4-8-13-9-6-7-11-20(13)15-12-14(17-10-5-2)18-16(19-15)21-3/h12-13H,4-11H2,1-3H3,(H,17,18,19) |
| InChIKey | BHPPKIBYVRHXSZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |