C12H15F3N2O2S2 — CID 83046895
N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83046895) has the molecular formula C12H15F3N2O2S2 and a molecular weight of 340.39 g/mol. Its IUPAC name is N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83046895 |
| Molecular Formula | C12H15F3N2O2S2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | NCC#Cc1ccsc1CNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2S2/c13-12(14,15)5-2-8-21(18,19)17-9-11-10(3-1-6-16)4-7-20-11/h4,7,17H,2,5-6,8-9,16H2 |
| InChIKey | GUTNTPBHNKARBN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|