C11H22F3N3O3S — CID 83047155
N'-hydroxy-3-[2-methylpropyl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide (PubChem CID 83047155) has the molecular formula C11H22F3N3O3S and a molecular weight of 333.38 g/mol. Its IUPAC name is N'-hydroxy-3-[2-methylpropyl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[2-methylpropyl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide |
|---|---|
| PubChem CID | 83047155 |
| Molecular Formula | C11H22F3N3O3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N'-hydroxy-3-[2-methylpropyl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide |
| SMILES | CC(C)CN(CCC(N)=NO)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H22F3N3O3S/c1-9(2)8-17(6-4-10(15)16-18)21(19,20)7-3-5-11(12,13)14/h9,18H,3-8H2,1-2H3,(H2,15,16) |
| InChIKey | HHSXJYCYHKMRNI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|