C8H13F3N4O4S2 — CID 83047283
1-methyl-3-(4,4,4-trifluorobutylsulfonylamino)pyrazole-4-sulfonamide (PubChem CID 83047283) has the molecular formula C8H13F3N4O4S2 and a molecular weight of 350.34 g/mol. Its IUPAC name is 1-methyl-3-(4,4,4-trifluorobutylsulfonylamino)pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-3-(4,4,4-trifluorobutylsulfonylamino)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 83047283 |
| Molecular Formula | C8H13F3N4O4S2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 1-methyl-3-(4,4,4-trifluorobutylsulfonylamino)pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(N)(=O)=O)c(NS(=O)(=O)CCCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H13F3N4O4S2/c1-15-5-6(21(12,18)19)7(13-15)14-20(16,17)4-2-3-8(9,10)11/h5H,2-4H2,1H3,(H,13,14)(H2,12,18,19) |
| InChIKey | QDZBWPIQRSAZAK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |