C13H23F3N2O2S — CID 83047394
1-(4,4,4-trifluorobutylsulfonyl)-1,4-diazaspiro[5.5]undecane (PubChem CID 83047394) has the molecular formula C13H23F3N2O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 1-(4,4,4-trifluorobutylsulfonyl)-1,4-diazaspiro[5.5]undecane.
| Compound Name | 1-(4,4,4-trifluorobutylsulfonyl)-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 83047394 |
| Molecular Formula | C13H23F3N2O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(4,4,4-trifluorobutylsulfonyl)-1,4-diazaspiro[5.5]undecane |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CCNCC12CCCCC2 |
| InChI | InChI=1S/C13H23F3N2O2S/c14-13(15,16)7-4-10-21(19,20)18-9-8-17-11-12(18)5-2-1-3-6-12/h17H,1-11H2 |
| InChIKey | LQPSGSGHMRETGH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |