C10H11F3N2O4S2 — CID 83047399
(E)-3-[2-(4,4,4-trifluorobutylsulfonylamino)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 83047399) has the molecular formula C10H11F3N2O4S2 and a molecular weight of 344.34 g/mol. Its IUPAC name is (E)-3-[2-(4,4,4-trifluorobutylsulfonylamino)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(4,4,4-trifluorobutylsulfonylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 83047399 |
| Molecular Formula | C10H11F3N2O4S2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | (E)-3-[2-(4,4,4-trifluorobutylsulfonylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(NS(=O)(=O)CCCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H11F3N2O4S2/c11-10(12,13)4-1-5-21(18,19)15-9-14-6-7(20-9)2-3-8(16)17/h2-3,6H,1,4-5H2,(H,14,15)(H,16,17)/b3-2+ |
| InChIKey | DSYNWRPXRVYALV-NSCUHMNNSA-N |
| XLogP | 2.33 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|