C12H15F3N2O2S2 — CID 83047887
4-(4,4,4-trifluorobutylsulfonyl)-2,3-dihydro-1,4-benzothiazin-6-amine (PubChem CID 83047887) has the molecular formula C12H15F3N2O2S2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutylsulfonyl)-2,3-dihydro-1,4-benzothiazin-6-amine.
| Compound Name | 4-(4,4,4-trifluorobutylsulfonyl)-2,3-dihydro-1,4-benzothiazin-6-amine |
|---|---|
| PubChem CID | 83047887 |
| Molecular Formula | C12H15F3N2O2S2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-(4,4,4-trifluorobutylsulfonyl)-2,3-dihydro-1,4-benzothiazin-6-amine |
| SMILES | Nc1ccc2c(c1)N(S(=O)(=O)CCCC(F)(F)F)CCS2 |
| InChI | InChI=1S/C12H15F3N2O2S2/c13-12(14,15)4-1-7-21(18,19)17-5-6-20-11-3-2-9(16)8-10(11)17/h2-3,8H,1,4-7,16H2 |
| InChIKey | KXGLSDXRHIRVGP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|