About 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide
2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide (PubChem CID 83048045) has the molecular formula C12H22F3N3O2S
and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide.
Molecular Properties
| Compound Name | 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide |
| PubChem CID | 83048045 |
| Molecular Formula | C12H22F3N3O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide |
| SMILES | [H]/N=C(\N)C(NS(=O)(=O)CCCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C12H22F3N3O2S/c13-12(14,15)7-4-8-21(19,20)18-10(11(16)17)9-5-2-1-3-6-9/h9-10,18H,1-8H2,(H3,16,17) |
| InChIKey | QDYSZJBJYGWGGY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide?
The IUPAC name of 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide (CID 83048045) is 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide.
What is the SMILES notation for 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide?
The canonical SMILES for 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide is [H]/N=C(\N)C(NS(=O)(=O)CCCC(F)(F)F)C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide?
The InChIKey is QDYSZJBJYGWGGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3N3O2S/c13-12(14,15)7-4-8-21(19,20)18-10(11(16)17)9-5-2-1-3-6-9/h9-10,18H,1-8H2,(H3,16,17).
What are the key properties of 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide?
2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide has a molecular weight of 329.39 g/mol, XLogP of 2.13, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanimidamide is sourced from PubChem (CID 83048045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).