About 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide
2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide (PubChem CID 83048164) has the molecular formula C12H21F3N2O2S2
and a molecular weight of 346.44 g/mol. Its IUPAC name is 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide.
Molecular Properties
| Compound Name | 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide |
| PubChem CID | 83048164 |
| Molecular Formula | C12H21F3N2O2S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide |
| SMILES | NC(=S)C(NS(=O)(=O)CCCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C12H21F3N2O2S2/c13-12(14,15)7-4-8-21(18,19)17-10(11(16)20)9-5-2-1-3-6-9/h9-10,17H,1-8H2,(H2,16,20) |
| InChIKey | PCHVJBOIAXICOC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide?
The IUPAC name of 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide (CID 83048164) is 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide.
What is the SMILES notation for 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide?
The canonical SMILES for 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide is NC(=S)C(NS(=O)(=O)CCCC(F)(F)F)C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide?
The InChIKey is PCHVJBOIAXICOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O2S2/c13-12(14,15)7-4-8-21(18,19)17-10(11(16)20)9-5-2-1-3-6-9/h9-10,17H,1-8H2,(H2,16,20).
What are the key properties of 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide?
2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide has a molecular weight of 346.44 g/mol, XLogP of 2.48, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-(4,4,4-trifluorobutylsulfonylamino)ethanethioamide is sourced from PubChem (CID 83048164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).